C16H24N2O4S — CID 51163346
N-(2-methyl-2-morpholin-4-ylpropyl)-3-methylsulfonylbenzamide (PubChem CID 51163346) has the molecular formula C16H24N2O4S and a molecular weight of 340.44 g/mol. Its IUPAC name is N-(2-methyl-2-morpholin-4-ylpropyl)-3-methylsulfonylbenzamide.
| Compound Name | N-(2-methyl-2-morpholin-4-ylpropyl)-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 51163346 |
| Molecular Formula | C16H24N2O4S |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | N-(2-methyl-2-morpholin-4-ylpropyl)-3-methylsulfonylbenzamide |
| SMILES | CC(C)(CNC(=O)c1cccc(S(C)(=O)=O)c1)N1CCOCC1 |
| InChI | InChI=1S/C16H24N2O4S/c1-16(2,18-7-9-22-10-8-18)12-17-15(19)13-5-4-6-14(11-13)23(3,20)21/h4-6,11H,7-10,12H2,1-3H3,(H,17,19) |
| InChIKey | WDIGHGMRUXLSAB-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |