C16H17F2NO4S — CID 51169219
N-[[4-(difluoromethoxy)phenyl]methyl]-2-methoxy-N-methylbenzenesulfonamide (PubChem CID 51169219) has the molecular formula C16H17F2NO4S and a molecular weight of 357.38 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)phenyl]methyl]-2-methoxy-N-methylbenzenesulfonamide.
| Compound Name | N-[[4-(difluoromethoxy)phenyl]methyl]-2-methoxy-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 51169219 |
| Molecular Formula | C16H17F2NO4S |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | N-[[4-(difluoromethoxy)phenyl]methyl]-2-methoxy-N-methylbenzenesulfonamide |
| SMILES | COc1ccccc1S(=O)(=O)N(C)Cc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C16H17F2NO4S/c1-19(11-12-7-9-13(10-8-12)23-16(17)18)24(20,21)15-6-4-3-5-14(15)22-2/h3-10,16H,11H2,1-2H3 |
| InChIKey | TURKJQMKZLYOEO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |