C17H20F2N2O2S — CID 51169617
N-[2-(dimethylamino)-3-phenylpropyl]-2,6-difluorobenzenesulfonamide (PubChem CID 51169617) has the molecular formula C17H20F2N2O2S and a molecular weight of 354.42 g/mol. Its IUPAC name is N-[2-(dimethylamino)-3-phenylpropyl]-2,6-difluorobenzenesulfonamide.
| Compound Name | N-[2-(dimethylamino)-3-phenylpropyl]-2,6-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 51169617 |
| Molecular Formula | C17H20F2N2O2S |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | N-[2-(dimethylamino)-3-phenylpropyl]-2,6-difluorobenzenesulfonamide |
| SMILES | CN(C)C(CNS(=O)(=O)c1c(F)cccc1F)Cc1ccccc1 |
| InChI | InChI=1S/C17H20F2N2O2S/c1-21(2)14(11-13-7-4-3-5-8-13)12-20-24(22,23)17-15(18)9-6-10-16(17)19/h3-10,14,20H,11-12H2,1-2H3 |
| InChIKey | KQHNFZMXAPBPDC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |