C15H18N2O2S — CID 51172455
2-(4-ethoxyphenyl)-N,N,4-trimethyl-1,3-thiazole-5-carboxamide (PubChem CID 51172455) has the molecular formula C15H18N2O2S and a molecular weight of 290.39 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-N,N,4-trimethyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(4-ethoxyphenyl)-N,N,4-trimethyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 51172455 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 2-(4-ethoxyphenyl)-N,N,4-trimethyl-1,3-thiazole-5-carboxamide |
| SMILES | CCOc1ccc(-c2nc(C)c(C(=O)N(C)C)s2)cc1 |
| InChI | InChI=1S/C15H18N2O2S/c1-5-19-12-8-6-11(7-9-12)14-16-10(2)13(20-14)15(18)17(3)4/h6-9H,5H2,1-4H3 |
| InChIKey | QKQVVYACQRCIHQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |