C16H13ClFNO2 — CID 51173221
2-chloro-N-(3,4-dihydro-2H-chromen-4-yl)-6-fluorobenzamide (PubChem CID 51173221) has the molecular formula C16H13ClFNO2 and a molecular weight of 305.74 g/mol. Its IUPAC name is 2-chloro-N-(3,4-dihydro-2H-chromen-4-yl)-6-fluorobenzamide.
| Compound Name | 2-chloro-N-(3,4-dihydro-2H-chromen-4-yl)-6-fluorobenzamide |
|---|---|
| PubChem CID | 51173221 |
| Molecular Formula | C16H13ClFNO2 |
| Molecular Weight | 305.74 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 2-chloro-N-(3,4-dihydro-2H-chromen-4-yl)-6-fluorobenzamide |
| SMILES | O=C(NC1CCOc2ccccc21)c1c(F)cccc1Cl |
| InChI | InChI=1S/C16H13ClFNO2/c17-11-5-3-6-12(18)15(11)16(20)19-13-8-9-21-14-7-2-1-4-10(13)14/h1-7,13H,8-9H2,(H,19,20) |
| InChIKey | BPOOVRMHAKUHNK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.74 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |