About 3-(ethylsulfanylmethyl)-8-methylimidazo[1,2-a]pyridine
3-(ethylsulfanylmethyl)-8-methylimidazo[1,2-a]pyridine (PubChem CID 511746) has the molecular formula C11H14N2S
and a molecular weight of 206.31 g/mol. Its IUPAC name is 3-(ethylsulfanylmethyl)-8-methylimidazo[1,2-a]pyridine.
Analyze 3-(ethylsulfanylmethyl)-8-methylimidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(ethylsulfanylmethyl)-8-methylimidazo[1,2-a]pyridine?
The IUPAC name of 3-(ethylsulfanylmethyl)-8-methylimidazo[1,2-a]pyridine (CID 511746) is 3-(ethylsulfanylmethyl)-8-methylimidazo[1,2-a]pyridine.
What is the SMILES notation for 3-(ethylsulfanylmethyl)-8-methylimidazo[1,2-a]pyridine?
The canonical SMILES for 3-(ethylsulfanylmethyl)-8-methylimidazo[1,2-a]pyridine is CCSCc1cnc2c(C)cccn12.
What is the InChIKey of 3-(ethylsulfanylmethyl)-8-methylimidazo[1,2-a]pyridine?
The InChIKey is WDSCCMXRTVRMTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2S/c1-3-14-8-10-7-12-11-9(2)5-4-6-13(10)11/h4-7H,3,8H2,1-2H3.
What are the key properties of 3-(ethylsulfanylmethyl)-8-methylimidazo[1,2-a]pyridine?
3-(ethylsulfanylmethyl)-8-methylimidazo[1,2-a]pyridine has a molecular weight of 206.31 g/mol, XLogP of 2.90, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(ethylsulfanylmethyl)-8-methylimidazo[1,2-a]pyridine is sourced from PubChem (CID 511746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).