About 2-[(8-methylimidazo[1,2-a]pyridin-3-yl)methylsulfanyl]ethanol
2-[(8-methylimidazo[1,2-a]pyridin-3-yl)methylsulfanyl]ethanol (PubChem CID 511748) has the molecular formula C11H14N2OS
and a molecular weight of 222.31 g/mol. Its IUPAC name is 2-[(8-methylimidazo[1,2-a]pyridin-3-yl)methylsulfanyl]ethanol.
Molecular Properties
| Compound Name | 2-[(8-methylimidazo[1,2-a]pyridin-3-yl)methylsulfanyl]ethanol |
| PubChem CID | 511748 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 2-[(8-methylimidazo[1,2-a]pyridin-3-yl)methylsulfanyl]ethanol |
| SMILES | Cc1cccn2c(CSCCO)cnc12 |
| InChI | InChI=1S/C11H14N2OS/c1-9-3-2-4-13-10(7-12-11(9)13)8-15-6-5-14/h2-4,7,14H,5-6,8H2,1H3 |
| InChIKey | KVKIFFNEGQGKFT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(8-methylimidazo[1,2-a]pyridin-3-yl)methylsulfanyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(8-methylimidazo[1,2-a]pyridin-3-yl)methylsulfanyl]ethanol?
The IUPAC name of 2-[(8-methylimidazo[1,2-a]pyridin-3-yl)methylsulfanyl]ethanol (CID 511748) is 2-[(8-methylimidazo[1,2-a]pyridin-3-yl)methylsulfanyl]ethanol.
What is the SMILES notation for 2-[(8-methylimidazo[1,2-a]pyridin-3-yl)methylsulfanyl]ethanol?
The canonical SMILES for 2-[(8-methylimidazo[1,2-a]pyridin-3-yl)methylsulfanyl]ethanol is Cc1cccn2c(CSCCO)cnc12.
What is the InChIKey of 2-[(8-methylimidazo[1,2-a]pyridin-3-yl)methylsulfanyl]ethanol?
The InChIKey is KVKIFFNEGQGKFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2OS/c1-9-3-2-4-13-10(7-12-11(9)13)8-15-6-5-14/h2-4,7,14H,5-6,8H2,1H3.
What are the key properties of 2-[(8-methylimidazo[1,2-a]pyridin-3-yl)methylsulfanyl]ethanol?
2-[(8-methylimidazo[1,2-a]pyridin-3-yl)methylsulfanyl]ethanol has a molecular weight of 222.31 g/mol, XLogP of 1.87, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(8-methylimidazo[1,2-a]pyridin-3-yl)methylsulfanyl]ethanol is sourced from PubChem (CID 511748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).