About 3-[(7-methylimidazo[1,2-a]pyridin-3-yl)methylsulfanyl]propan-1-ol
3-[(7-methylimidazo[1,2-a]pyridin-3-yl)methylsulfanyl]propan-1-ol (PubChem CID 511756) has the molecular formula C12H16N2OS
and a molecular weight of 236.34 g/mol. Its IUPAC name is 3-[(7-methylimidazo[1,2-a]pyridin-3-yl)methylsulfanyl]propan-1-ol.
Molecular Properties
| Compound Name | 3-[(7-methylimidazo[1,2-a]pyridin-3-yl)methylsulfanyl]propan-1-ol |
| PubChem CID | 511756 |
| Molecular Formula | C12H16N2OS |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 3-[(7-methylimidazo[1,2-a]pyridin-3-yl)methylsulfanyl]propan-1-ol |
| SMILES | Cc1ccn2c(CSCCCO)cnc2c1 |
| InChI | InChI=1S/C12H16N2OS/c1-10-3-4-14-11(8-13-12(14)7-10)9-16-6-2-5-15/h3-4,7-8,15H,2,5-6,9H2,1H3 |
| InChIKey | WVCSZMWHMOSTNS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(7-methylimidazo[1,2-a]pyridin-3-yl)methylsulfanyl]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(7-methylimidazo[1,2-a]pyridin-3-yl)methylsulfanyl]propan-1-ol?
The IUPAC name of 3-[(7-methylimidazo[1,2-a]pyridin-3-yl)methylsulfanyl]propan-1-ol (CID 511756) is 3-[(7-methylimidazo[1,2-a]pyridin-3-yl)methylsulfanyl]propan-1-ol.
What is the SMILES notation for 3-[(7-methylimidazo[1,2-a]pyridin-3-yl)methylsulfanyl]propan-1-ol?
The canonical SMILES for 3-[(7-methylimidazo[1,2-a]pyridin-3-yl)methylsulfanyl]propan-1-ol is Cc1ccn2c(CSCCCO)cnc2c1.
What is the InChIKey of 3-[(7-methylimidazo[1,2-a]pyridin-3-yl)methylsulfanyl]propan-1-ol?
The InChIKey is WVCSZMWHMOSTNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2OS/c1-10-3-4-14-11(8-13-12(14)7-10)9-16-6-2-5-15/h3-4,7-8,15H,2,5-6,9H2,1H3.
What are the key properties of 3-[(7-methylimidazo[1,2-a]pyridin-3-yl)methylsulfanyl]propan-1-ol?
3-[(7-methylimidazo[1,2-a]pyridin-3-yl)methylsulfanyl]propan-1-ol has a molecular weight of 236.34 g/mol, XLogP of 2.26, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(7-methylimidazo[1,2-a]pyridin-3-yl)methylsulfanyl]propan-1-ol is sourced from PubChem (CID 511756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).