C15H16N6O — CID 511805
6-[(3-methoxyanilino)methyl]pyrido[2,3-d]pyrimidine-2,4-diamine (PubChem CID 511805) has the molecular formula C15H16N6O and a molecular weight of 296.33 g/mol. Its IUPAC name is 6-[(3-methoxyanilino)methyl]pyrido[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 6-[(3-methoxyanilino)methyl]pyrido[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 511805 |
| Molecular Formula | C15H16N6O |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 6-[(3-methoxyanilino)methyl]pyrido[2,3-d]pyrimidine-2,4-diamine |
| SMILES | COc1cccc(NCc2cnc3nc(N)nc(N)c3c2)c1 |
| InChI | InChI=1S/C15H16N6O/c1-22-11-4-2-3-10(6-11)18-7-9-5-12-13(16)20-15(17)21-14(12)19-8-9/h2-6,8,18H,7H2,1H3,(H4,16,17,19,20,21) |
| InChIKey | HGIQAONNGREZAK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 111.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |