C17H15BrF2N2O2 — CID 51182017
N-(5-bromo-2-morpholin-4-ylphenyl)-2,4-difluorobenzamide (PubChem CID 51182017) has the molecular formula C17H15BrF2N2O2 and a molecular weight of 397.22 g/mol. Its IUPAC name is N-(5-bromo-2-morpholin-4-ylphenyl)-2,4-difluorobenzamide.
| Compound Name | N-(5-bromo-2-morpholin-4-ylphenyl)-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 51182017 |
| Molecular Formula | C17H15BrF2N2O2 |
| Molecular Weight | 397.22 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | N-(5-bromo-2-morpholin-4-ylphenyl)-2,4-difluorobenzamide |
| SMILES | O=C(Nc1cc(Br)ccc1N1CCOCC1)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H15BrF2N2O2/c18-11-1-4-16(22-5-7-24-8-6-22)15(9-11)21-17(23)13-3-2-12(19)10-14(13)20/h1-4,9-10H,5-8H2,(H,21,23) |
| InChIKey | HKEFPGHKRVPOLU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.22 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |