About methyl 2-[3-[(2,4-difluorobenzoyl)amino]propanoylamino]-4-methylpentanoate
methyl 2-[3-[(2,4-difluorobenzoyl)amino]propanoylamino]-4-methylpentanoate (PubChem CID 51192748) has the molecular formula C17H22F2N2O4
and a molecular weight of 356.37 g/mol. Its IUPAC name is methyl 2-[3-[(2,4-difluorobenzoyl)amino]propanoylamino]-4-methylpentanoate.
Molecular Properties
| Compound Name | methyl 2-[3-[(2,4-difluorobenzoyl)amino]propanoylamino]-4-methylpentanoate |
| PubChem CID | 51192748 |
| Molecular Formula | C17H22F2N2O4 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | methyl 2-[3-[(2,4-difluorobenzoyl)amino]propanoylamino]-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)NC(=O)CCNC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H22F2N2O4/c1-10(2)8-14(17(24)25-3)21-15(22)6-7-20-16(23)12-5-4-11(18)9-13(12)19/h4-5,9-10,14H,6-8H2,1-3H3,(H,20,23)(H,21,22) |
| InChIKey | HZOFLABUZKHRGU-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[3-[(2,4-difluorobenzoyl)amino]propanoylamino]-4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[3-[(2,4-difluorobenzoyl)amino]propanoylamino]-4-methylpentanoate?
The IUPAC name of methyl 2-[3-[(2,4-difluorobenzoyl)amino]propanoylamino]-4-methylpentanoate (CID 51192748) is methyl 2-[3-[(2,4-difluorobenzoyl)amino]propanoylamino]-4-methylpentanoate.
What is the SMILES notation for methyl 2-[3-[(2,4-difluorobenzoyl)amino]propanoylamino]-4-methylpentanoate?
The canonical SMILES for methyl 2-[3-[(2,4-difluorobenzoyl)amino]propanoylamino]-4-methylpentanoate is COC(=O)C(CC(C)C)NC(=O)CCNC(=O)c1ccc(F)cc1F.
What is the InChIKey of methyl 2-[3-[(2,4-difluorobenzoyl)amino]propanoylamino]-4-methylpentanoate?
The InChIKey is HZOFLABUZKHRGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22F2N2O4/c1-10(2)8-14(17(24)25-3)21-15(22)6-7-20-16(23)12-5-4-11(18)9-13(12)19/h4-5,9-10,14H,6-8H2,1-3H3,(H,20,23)(H,21,22).
What are the key properties of methyl 2-[3-[(2,4-difluorobenzoyl)amino]propanoylamino]-4-methylpentanoate?
methyl 2-[3-[(2,4-difluorobenzoyl)amino]propanoylamino]-4-methylpentanoate has a molecular weight of 356.37 g/mol, XLogP of 1.79, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[3-[(2,4-difluorobenzoyl)amino]propanoylamino]-4-methylpentanoate is sourced from PubChem (CID 51192748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).