C19H13FO5 — CID 5120629
9-(4-fluorophenyl)-5,13-dimethyl-2,6,12-trioxatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,13-tetraene-7,11-dione (PubChem CID 5120629) has the molecular formula C19H13FO5 and a molecular weight of 340.31 g/mol. Its IUPAC name is 9-(4-fluorophenyl)-5,13-dimethyl-2,6,12-trioxatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,13-tetraene-7,11-dione.
| Compound Name | 9-(4-fluorophenyl)-5,13-dimethyl-2,6,12-trioxatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,13-tetraene-7,11-dione |
|---|---|
| PubChem CID | 5120629 |
| Molecular Formula | C19H13FO5 |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 9-(4-fluorophenyl)-5,13-dimethyl-2,6,12-trioxatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,13-tetraene-7,11-dione |
| SMILES | Cc1cc2c(c(=O)o1)C(c1ccc(F)cc1)c1c(cc(C)oc1=O)O2 |
| InChI | InChI=1S/C19H13FO5/c1-9-7-13-16(18(21)23-9)15(11-3-5-12(20)6-4-11)17-14(25-13)8-10(2)24-19(17)22/h3-8,15H,1-2H3 |
| InChIKey | PGUXXSCRWVLBCC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 69.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |