C20H24N4O3 — CID 51208266
4-(2-ethoxyphenoxy)-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]butanamide (PubChem CID 51208266) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is 4-(2-ethoxyphenoxy)-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]butanamide.
| Compound Name | 4-(2-ethoxyphenoxy)-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 51208266 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 4-(2-ethoxyphenoxy)-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]butanamide |
| SMILES | CCOc1ccccc1OCCCC(=O)NCCc1nnc2ccccn12 |
| InChI | InChI=1S/C20H24N4O3/c1-2-26-16-8-3-4-9-17(16)27-15-7-11-20(25)21-13-12-19-23-22-18-10-5-6-14-24(18)19/h3-6,8-10,14H,2,7,11-13,15H2,1H3,(H,21,25) |
| InChIKey | UWHXKORIJMSUQR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|