About [(2,6-dimethylphenoxy)-hydroxyphosphoryl]formic acid
[(2,6-dimethylphenoxy)-hydroxyphosphoryl]formic acid (PubChem CID 512083) has the molecular formula C9H11O5P
and a molecular weight of 230.16 g/mol. Its IUPAC name is [(2,6-dimethylphenoxy)-hydroxyphosphoryl]formic acid.
Molecular Properties
| Compound Name | [(2,6-dimethylphenoxy)-hydroxyphosphoryl]formic acid |
| PubChem CID | 512083 |
| Molecular Formula | C9H11O5P |
| Molecular Weight | 230.16 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | [(2,6-dimethylphenoxy)-hydroxyphosphoryl]formic acid |
| SMILES | Cc1cccc(C)c1OP(=O)(O)C(=O)O |
| InChI | InChI=1S/C9H11O5P/c1-6-4-3-5-7(2)8(6)14-15(12,13)9(10)11/h3-5H,1-2H3,(H,10,11)(H,12,13) |
| InChIKey | UDMAMOSHMFXDDK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.16 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(2,6-dimethylphenoxy)-hydroxyphosphoryl]formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2,6-dimethylphenoxy)-hydroxyphosphoryl]formic acid?
The IUPAC name of [(2,6-dimethylphenoxy)-hydroxyphosphoryl]formic acid (CID 512083) is [(2,6-dimethylphenoxy)-hydroxyphosphoryl]formic acid.
What is the SMILES notation for [(2,6-dimethylphenoxy)-hydroxyphosphoryl]formic acid?
The canonical SMILES for [(2,6-dimethylphenoxy)-hydroxyphosphoryl]formic acid is Cc1cccc(C)c1OP(=O)(O)C(=O)O.
What is the InChIKey of [(2,6-dimethylphenoxy)-hydroxyphosphoryl]formic acid?
The InChIKey is UDMAMOSHMFXDDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11O5P/c1-6-4-3-5-7(2)8(6)14-15(12,13)9(10)11/h3-5H,1-2H3,(H,10,11)(H,12,13).
What are the key properties of [(2,6-dimethylphenoxy)-hydroxyphosphoryl]formic acid?
[(2,6-dimethylphenoxy)-hydroxyphosphoryl]formic acid has a molecular weight of 230.16 g/mol, XLogP of 2.55, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2,6-dimethylphenoxy)-hydroxyphosphoryl]formic acid is sourced from PubChem (CID 512083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).