C19H29N3O4 — CID 51211332
N-[2-(tert-butylamino)-2-oxoethyl]-N-ethyl-1-(furan-2-carbonyl)piperidine-4-carboxamide (PubChem CID 51211332) has the molecular formula C19H29N3O4 and a molecular weight of 363.46 g/mol. Its IUPAC name is N-[2-(tert-butylamino)-2-oxoethyl]-N-ethyl-1-(furan-2-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-[2-(tert-butylamino)-2-oxoethyl]-N-ethyl-1-(furan-2-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 51211332 |
| Molecular Formula | C19H29N3O4 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | N-[2-(tert-butylamino)-2-oxoethyl]-N-ethyl-1-(furan-2-carbonyl)piperidine-4-carboxamide |
| SMILES | CCN(CC(=O)NC(C)(C)C)C(=O)C1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C19H29N3O4/c1-5-21(13-16(23)20-19(2,3)4)17(24)14-8-10-22(11-9-14)18(25)15-7-6-12-26-15/h6-7,12,14H,5,8-11,13H2,1-4H3,(H,20,23) |
| InChIKey | TYWYBOLRNZCJCT-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |