C22H20N4O3 — CID 51211336
2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-(2-methyl-1,3-dioxoisoindol-5-yl)acetamide (PubChem CID 51211336) has the molecular formula C22H20N4O3 and a molecular weight of 388.43 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-(2-methyl-1,3-dioxoisoindol-5-yl)acetamide.
| Compound Name | 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-(2-methyl-1,3-dioxoisoindol-5-yl)acetamide |
|---|---|
| PubChem CID | 51211336 |
| Molecular Formula | C22H20N4O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-(2-methyl-1,3-dioxoisoindol-5-yl)acetamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1CC(=O)Nc1ccc2c(c1)C(=O)N(C)C2=O |
| InChI | InChI=1S/C22H20N4O3/c1-13-18(14(2)26(24-13)16-7-5-4-6-8-16)12-20(27)23-15-9-10-17-19(11-15)22(29)25(3)21(17)28/h4-11H,12H2,1-3H3,(H,23,27) |
| InChIKey | NHGJXVUPHSTSBS-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|