C16H25NO2 — CID 51212300
N-[1-(2-methoxy-5-methylphenyl)ethyl]-3,3-dimethylbutanamide (PubChem CID 51212300) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is N-[1-(2-methoxy-5-methylphenyl)ethyl]-3,3-dimethylbutanamide.
| Compound Name | N-[1-(2-methoxy-5-methylphenyl)ethyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 51212300 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | N-[1-(2-methoxy-5-methylphenyl)ethyl]-3,3-dimethylbutanamide |
| SMILES | COc1ccc(C)cc1C(C)NC(=O)CC(C)(C)C |
| InChI | InChI=1S/C16H25NO2/c1-11-7-8-14(19-6)13(9-11)12(2)17-15(18)10-16(3,4)5/h7-9,12H,10H2,1-6H3,(H,17,18) |
| InChIKey | UOFXIOPFAFSOAJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |