C28H20N2O5 — CID 5121421
(1,3-dioxoisoindol-2-yl)methyl 4-(furan-2-ylmethylidene)-2,3-dihydro-1H-acridine-9-carboxylate (PubChem CID 5121421) has the molecular formula C28H20N2O5 and a molecular weight of 464.48 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl 4-(furan-2-ylmethylidene)-2,3-dihydro-1H-acridine-9-carboxylate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl 4-(furan-2-ylmethylidene)-2,3-dihydro-1H-acridine-9-carboxylate |
|---|---|
| PubChem CID | 5121421 |
| Molecular Formula | C28H20N2O5 |
| Molecular Weight | 464.48 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl 4-(furan-2-ylmethylidene)-2,3-dihydro-1H-acridine-9-carboxylate |
| SMILES | O=C(OCN1C(=O)c2ccccc2C1=O)c1c2c(nc3ccccc13)C(=Cc1ccco1)CCC2 |
| InChI | InChI=1S/C28H20N2O5/c31-26-19-9-1-2-10-20(19)27(32)30(26)16-35-28(33)24-21-11-3-4-13-23(21)29-25-17(7-5-12-22(24)25)15-18-8-6-14-34-18/h1-4,6,8-11,13-15H,5,7,12,16H2 |
| InChIKey | DUKOCOLDZWBTQB-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 89.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.48 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|