C18H26N2O3 — CID 51217085
tert-butyl N-[4-(2-methyl-2,3-dihydroindol-1-yl)-4-oxobutyl]carbamate (PubChem CID 51217085) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is tert-butyl N-[4-(2-methyl-2,3-dihydroindol-1-yl)-4-oxobutyl]carbamate.
| Compound Name | tert-butyl N-[4-(2-methyl-2,3-dihydroindol-1-yl)-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 51217085 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | tert-butyl N-[4-(2-methyl-2,3-dihydroindol-1-yl)-4-oxobutyl]carbamate |
| SMILES | CC1Cc2ccccc2N1C(=O)CCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H26N2O3/c1-13-12-14-8-5-6-9-15(14)20(13)16(21)10-7-11-19-17(22)23-18(2,3)4/h5-6,8-9,13H,7,10-12H2,1-4H3,(H,19,22) |
| InChIKey | FYGHDAMTOFKJAP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|