C29H21Cl3N2S — CID 5121913
5-(2-chlorophenyl)-3-(4-chlorophenyl)-9-[(2-chlorophenyl)methylidene]-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazoline (PubChem CID 5121913) has the molecular formula C29H21Cl3N2S and a molecular weight of 535.93 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-3-(4-chlorophenyl)-9-[(2-chlorophenyl)methylidene]-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazoline.
| Compound Name | 5-(2-chlorophenyl)-3-(4-chlorophenyl)-9-[(2-chlorophenyl)methylidene]-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazoline |
|---|---|
| PubChem CID | 5121913 |
| Molecular Formula | C29H21Cl3N2S |
| Molecular Weight | 535.93 g/mol |
| Exact Mass | 534.05 |
| IUPAC Name | 5-(2-chlorophenyl)-3-(4-chlorophenyl)-9-[(2-chlorophenyl)methylidene]-5,6,7,8-tetrahydro-[1,3]thiazolo[2,3-b]quinazoline |
| SMILES | Clc1ccc(C2=CSC3=NC4=C(CCCC4=Cc4ccccc4Cl)C(c4ccccc4Cl)N23)cc1 |
| InChI | InChI=1S/C29H21Cl3N2S/c30-21-14-12-18(13-15-21)26-17-35-29-33-27-20(16-19-6-1-3-10-24(19)31)7-5-9-23(27)28(34(26)29)22-8-2-4-11-25(22)32/h1-4,6,8,10-17,28H,5,7,9H2 |
| InChIKey | SIZQKBNCTRMWKQ-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.93 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |