C25H25N3O4 — CID 5122112
(1,10,10-trimethyl-3-phenyl-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-dien-5-yl)methyl 4-nitrobenzoate (PubChem CID 5122112) has the molecular formula C25H25N3O4 and a molecular weight of 431.49 g/mol. Its IUPAC name is (1,10,10-trimethyl-3-phenyl-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-dien-5-yl)methyl 4-nitrobenzoate.
| Compound Name | (1,10,10-trimethyl-3-phenyl-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-dien-5-yl)methyl 4-nitrobenzoate |
|---|---|
| PubChem CID | 5122112 |
| Molecular Formula | C25H25N3O4 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | (1,10,10-trimethyl-3-phenyl-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-dien-5-yl)methyl 4-nitrobenzoate |
| SMILES | CC12CCC(c3c(COC(=O)c4ccc([N+](=O)[O-])cc4)nn(-c4ccccc4)c31)C2(C)C |
| InChI | InChI=1S/C25H25N3O4/c1-24(2)19-13-14-25(24,3)22-21(19)20(26-27(22)17-7-5-4-6-8-17)15-32-23(29)16-9-11-18(12-10-16)28(30)31/h4-12,19H,13-15H2,1-3H3 |
| InChIKey | LSVZGDAECPERIW-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|