C20H25N3O2 — CID 51221242
N-(1-acetylpiperidin-4-yl)-4-(2,5-dimethylpyrrol-1-yl)benzamide (PubChem CID 51221242) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is N-(1-acetylpiperidin-4-yl)-4-(2,5-dimethylpyrrol-1-yl)benzamide.
| Compound Name | N-(1-acetylpiperidin-4-yl)-4-(2,5-dimethylpyrrol-1-yl)benzamide |
|---|---|
| PubChem CID | 51221242 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | N-(1-acetylpiperidin-4-yl)-4-(2,5-dimethylpyrrol-1-yl)benzamide |
| SMILES | CC(=O)N1CCC(NC(=O)c2ccc(-n3c(C)ccc3C)cc2)CC1 |
| InChI | InChI=1S/C20H25N3O2/c1-14-4-5-15(2)23(14)19-8-6-17(7-9-19)20(25)21-18-10-12-22(13-11-18)16(3)24/h4-9,18H,10-13H2,1-3H3,(H,21,25) |
| InChIKey | ZYIMQSVOWYVBEK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|