C23H15Br2NO3 — CID 5122182
1,8-dibromo-17-(furan-2-ylmethyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 5122182) has the molecular formula C23H15Br2NO3 and a molecular weight of 513.19 g/mol. Its IUPAC name is 1,8-dibromo-17-(furan-2-ylmethyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | 1,8-dibromo-17-(furan-2-ylmethyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 5122182 |
| Molecular Formula | C23H15Br2NO3 |
| Molecular Weight | 513.19 g/mol |
| Exact Mass | 510.94 |
| IUPAC Name | 1,8-dibromo-17-(furan-2-ylmethyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | O=C1C2C(C(=O)N1Cc1ccco1)C1(Br)c3ccccc3C2(Br)c2ccccc21 |
| InChI | InChI=1S/C23H15Br2NO3/c24-22-14-7-1-2-8-15(14)23(25,17-10-4-3-9-16(17)22)19-18(22)20(27)26(21(19)28)12-13-6-5-11-29-13/h1-11,18-19H,12H2 |
| InChIKey | BGKDRAJBUFXXQB-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.19 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|