C20H22N4O3S — CID 51222022
N-[3-(benzimidazol-1-yl)propyl]-1-methylsulfonyl-2,3-dihydroindole-5-carboxamide (PubChem CID 51222022) has the molecular formula C20H22N4O3S and a molecular weight of 398.49 g/mol. Its IUPAC name is N-[3-(benzimidazol-1-yl)propyl]-1-methylsulfonyl-2,3-dihydroindole-5-carboxamide.
| Compound Name | N-[3-(benzimidazol-1-yl)propyl]-1-methylsulfonyl-2,3-dihydroindole-5-carboxamide |
|---|---|
| PubChem CID | 51222022 |
| Molecular Formula | C20H22N4O3S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | N-[3-(benzimidazol-1-yl)propyl]-1-methylsulfonyl-2,3-dihydroindole-5-carboxamide |
| SMILES | CS(=O)(=O)N1CCc2cc(C(=O)NCCCn3cnc4ccccc43)ccc21 |
| InChI | InChI=1S/C20H22N4O3S/c1-28(26,27)24-12-9-15-13-16(7-8-18(15)24)20(25)21-10-4-11-23-14-22-17-5-2-3-6-19(17)23/h2-3,5-8,13-14H,4,9-12H2,1H3,(H,21,25) |
| InChIKey | AONIYKJFOLBRMB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|