C13H17NO4S2 — CID 5122350
3-(2,5,6-trimethyl-1,3-benzothiazol-3-ium-3-yl)propyl sulfate (PubChem CID 5122350) has the molecular formula C13H17NO4S2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 3-(2,5,6-trimethyl-1,3-benzothiazol-3-ium-3-yl)propyl sulfate.
| Compound Name | 3-(2,5,6-trimethyl-1,3-benzothiazol-3-ium-3-yl)propyl sulfate |
|---|---|
| PubChem CID | 5122350 |
| Molecular Formula | C13H17NO4S2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 3-(2,5,6-trimethyl-1,3-benzothiazol-3-ium-3-yl)propyl sulfate |
| SMILES | Cc1cc2sc(C)[n+](CCCOS(=O)(=O)[O-])c2cc1C |
| InChI | InChI=1S/C13H17NO4S2/c1-9-7-12-13(8-10(9)2)19-11(3)14(12)5-4-6-18-20(15,16)17/h7-8H,4-6H2,1-3H3 |
| InChIKey | IEMOWXZEHDESAP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 70.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|