About 2-[2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]acetamide
2-[2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]acetamide (PubChem CID 51224148) has the molecular formula C14H20N2O3
and a molecular weight of 264.32 g/mol. Its IUPAC name is 2-[2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]acetamide.
Molecular Properties
| Compound Name | 2-[2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]acetamide |
| PubChem CID | 51224148 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 2-[2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]acetamide |
| SMILES | COc1ccc(C2CCCN2CC(N)=O)c(OC)c1 |
| InChI | InChI=1S/C14H20N2O3/c1-18-10-5-6-11(13(8-10)19-2)12-4-3-7-16(12)9-14(15)17/h5-6,8,12H,3-4,7,9H2,1-2H3,(H2,15,17) |
| InChIKey | RIHAVEVJGRBZLM-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]acetamide?
The IUPAC name of 2-[2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]acetamide (CID 51224148) is 2-[2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]acetamide.
What is the SMILES notation for 2-[2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]acetamide?
The canonical SMILES for 2-[2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]acetamide is COc1ccc(C2CCCN2CC(N)=O)c(OC)c1.
What is the InChIKey of 2-[2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]acetamide?
The InChIKey is RIHAVEVJGRBZLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O3/c1-18-10-5-6-11(13(8-10)19-2)12-4-3-7-16(12)9-14(15)17/h5-6,8,12H,3-4,7,9H2,1-2H3,(H2,15,17).
What are the key properties of 2-[2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]acetamide?
2-[2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]acetamide has a molecular weight of 264.32 g/mol, XLogP of 1.33, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]acetamide is sourced from PubChem (CID 51224148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).