C21H23ClN4O2 — CID 51225270
2-(3-chlorophenyl)-5-[1-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-1,3,4-oxadiazole (PubChem CID 51225270) has the molecular formula C21H23ClN4O2 and a molecular weight of 398.89 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-5-[1-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-1,3,4-oxadiazole.
| Compound Name | 2-(3-chlorophenyl)-5-[1-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 51225270 |
| Molecular Formula | C21H23ClN4O2 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 2-(3-chlorophenyl)-5-[1-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-1,3,4-oxadiazole |
| SMILES | COc1ccc(N2CCN(C(C)c3nnc(-c4cccc(Cl)c4)o3)CC2)cc1 |
| InChI | InChI=1S/C21H23ClN4O2/c1-15(20-23-24-21(28-20)16-4-3-5-17(22)14-16)25-10-12-26(13-11-25)18-6-8-19(27-2)9-7-18/h3-9,14-15H,10-13H2,1-2H3 |
| InChIKey | RNCVQAWUTCPOJJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 54.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|