About benzyl 2-(2,2-dimethoxyethylcarbamoyl)pyrrolidine-1-carboxylate
benzyl 2-(2,2-dimethoxyethylcarbamoyl)pyrrolidine-1-carboxylate (PubChem CID 5122552) has the molecular formula C17H24N2O5
and a molecular weight of 336.39 g/mol. Its IUPAC name is benzyl 2-(2,2-dimethoxyethylcarbamoyl)pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | benzyl 2-(2,2-dimethoxyethylcarbamoyl)pyrrolidine-1-carboxylate |
| PubChem CID | 5122552 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | benzyl 2-(2,2-dimethoxyethylcarbamoyl)pyrrolidine-1-carboxylate |
| SMILES | COC(CNC(=O)C1CCCN1C(=O)OCc1ccccc1)OC |
| InChI | InChI=1S/C17H24N2O5/c1-22-15(23-2)11-18-16(20)14-9-6-10-19(14)17(21)24-12-13-7-4-3-5-8-13/h3-5,7-8,14-15H,6,9-12H2,1-2H3,(H,18,20) |
| InChIKey | UMVBAKPOYZHSSK-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze benzyl 2-(2,2-dimethoxyethylcarbamoyl)pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-(2,2-dimethoxyethylcarbamoyl)pyrrolidine-1-carboxylate?
The IUPAC name of benzyl 2-(2,2-dimethoxyethylcarbamoyl)pyrrolidine-1-carboxylate (CID 5122552) is benzyl 2-(2,2-dimethoxyethylcarbamoyl)pyrrolidine-1-carboxylate.
What is the SMILES notation for benzyl 2-(2,2-dimethoxyethylcarbamoyl)pyrrolidine-1-carboxylate?
The canonical SMILES for benzyl 2-(2,2-dimethoxyethylcarbamoyl)pyrrolidine-1-carboxylate is COC(CNC(=O)C1CCCN1C(=O)OCc1ccccc1)OC.
What is the InChIKey of benzyl 2-(2,2-dimethoxyethylcarbamoyl)pyrrolidine-1-carboxylate?
The InChIKey is UMVBAKPOYZHSSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2O5/c1-22-15(23-2)11-18-16(20)14-9-6-10-19(14)17(21)24-12-13-7-4-3-5-8-13/h3-5,7-8,14-15H,6,9-12H2,1-2H3,(H,18,20).
What are the key properties of benzyl 2-(2,2-dimethoxyethylcarbamoyl)pyrrolidine-1-carboxylate?
benzyl 2-(2,2-dimethoxyethylcarbamoyl)pyrrolidine-1-carboxylate has a molecular weight of 336.39 g/mol, XLogP of 1.52, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-(2,2-dimethoxyethylcarbamoyl)pyrrolidine-1-carboxylate is sourced from PubChem (CID 5122552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).