C15H23N3OS — CID 51226338
N-[4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ylmethyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 51226338) has the molecular formula C15H23N3OS and a molecular weight of 293.44 g/mol. Its IUPAC name is N-[4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ylmethyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ylmethyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 51226338 |
| Molecular Formula | C15H23N3OS |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | N-[4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ylmethyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(CN2CCCC3CCCCC32)cs1 |
| InChI | InChI=1S/C15H23N3OS/c1-11(19)16-15-17-13(10-20-15)9-18-8-4-6-12-5-2-3-7-14(12)18/h10,12,14H,2-9H2,1H3,(H,16,17,19) |
| InChIKey | KEDKTFFVOUMBSJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |