C28H26N2O6 — CID 5122897
1-(furan-2-ylmethyl)-5-[[3-methoxy-4-[(3-methylphenyl)methoxy]-5-prop-2-enylphenyl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 5122897) has the molecular formula C28H26N2O6 and a molecular weight of 486.52 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-5-[[3-methoxy-4-[(3-methylphenyl)methoxy]-5-prop-2-enylphenyl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(furan-2-ylmethyl)-5-[[3-methoxy-4-[(3-methylphenyl)methoxy]-5-prop-2-enylphenyl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 5122897 |
| Molecular Formula | C28H26N2O6 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 1-(furan-2-ylmethyl)-5-[[3-methoxy-4-[(3-methylphenyl)methoxy]-5-prop-2-enylphenyl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | C=CCc1cc(C=C2C(=O)NC(=O)N(Cc3ccco3)C2=O)cc(OC)c1OCc1cccc(C)c1 |
| InChI | InChI=1S/C28H26N2O6/c1-4-7-21-13-20(15-24(34-3)25(21)36-17-19-9-5-8-18(2)12-19)14-23-26(31)29-28(33)30(27(23)32)16-22-10-6-11-35-22/h4-6,8-15H,1,7,16-17H2,2-3H3,(H,29,31,33) |
| InChIKey | UKBSDEFDXASYJQ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|