C22H23N3O2S — CID 51234719
N-[(4-methylphenyl)methyl]-2-(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylpropanamide (PubChem CID 51234719) has the molecular formula C22H23N3O2S and a molecular weight of 393.51 g/mol. Its IUPAC name is N-[(4-methylphenyl)methyl]-2-(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylpropanamide.
| Compound Name | N-[(4-methylphenyl)methyl]-2-(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 51234719 |
| Molecular Formula | C22H23N3O2S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | N-[(4-methylphenyl)methyl]-2-(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylpropanamide |
| SMILES | C=CCn1c(SC(C)C(=O)NCc2ccc(C)cc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C22H23N3O2S/c1-4-13-25-21(27)18-7-5-6-8-19(18)24-22(25)28-16(3)20(26)23-14-17-11-9-15(2)10-12-17/h4-12,16H,1,13-14H2,2-3H3,(H,23,26) |
| InChIKey | GHSYBZXMBSXWTF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|