C22H25N3O2S — CID 51235207
2-(4-oxo-3-propan-2-ylquinazolin-2-yl)sulfanyl-N-(2-phenylethyl)propanamide (PubChem CID 51235207) has the molecular formula C22H25N3O2S and a molecular weight of 395.53 g/mol. Its IUPAC name is 2-(4-oxo-3-propan-2-ylquinazolin-2-yl)sulfanyl-N-(2-phenylethyl)propanamide.
| Compound Name | 2-(4-oxo-3-propan-2-ylquinazolin-2-yl)sulfanyl-N-(2-phenylethyl)propanamide |
|---|---|
| PubChem CID | 51235207 |
| Molecular Formula | C22H25N3O2S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 2-(4-oxo-3-propan-2-ylquinazolin-2-yl)sulfanyl-N-(2-phenylethyl)propanamide |
| SMILES | CC(Sc1nc2ccccc2c(=O)n1C(C)C)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C22H25N3O2S/c1-15(2)25-21(27)18-11-7-8-12-19(18)24-22(25)28-16(3)20(26)23-14-13-17-9-5-4-6-10-17/h4-12,15-16H,13-14H2,1-3H3,(H,23,26) |
| InChIKey | OKZYTDQQXQBGPC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |