C21H23N3O3S — CID 51235651
N-(2-ethoxyphenyl)-2-[1-(3-methoxyphenyl)imidazol-2-yl]sulfanylpropanamide (PubChem CID 51235651) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is N-(2-ethoxyphenyl)-2-[1-(3-methoxyphenyl)imidazol-2-yl]sulfanylpropanamide.
| Compound Name | N-(2-ethoxyphenyl)-2-[1-(3-methoxyphenyl)imidazol-2-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 51235651 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | N-(2-ethoxyphenyl)-2-[1-(3-methoxyphenyl)imidazol-2-yl]sulfanylpropanamide |
| SMILES | CCOc1ccccc1NC(=O)C(C)Sc1nccn1-c1cccc(OC)c1 |
| InChI | InChI=1S/C21H23N3O3S/c1-4-27-19-11-6-5-10-18(19)23-20(25)15(2)28-21-22-12-13-24(21)16-8-7-9-17(14-16)26-3/h5-15H,4H2,1-3H3,(H,23,25) |
| InChIKey | ALYJBYIOKVSUTA-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |