C16H14BrF2NO2 — CID 51236277
2-(2-bromo-4-methylphenoxy)-N-(2,6-difluorophenyl)propanamide (PubChem CID 51236277) has the molecular formula C16H14BrF2NO2 and a molecular weight of 370.19 g/mol. Its IUPAC name is 2-(2-bromo-4-methylphenoxy)-N-(2,6-difluorophenyl)propanamide.
| Compound Name | 2-(2-bromo-4-methylphenoxy)-N-(2,6-difluorophenyl)propanamide |
|---|---|
| PubChem CID | 51236277 |
| Molecular Formula | C16H14BrF2NO2 |
| Molecular Weight | 370.19 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | 2-(2-bromo-4-methylphenoxy)-N-(2,6-difluorophenyl)propanamide |
| SMILES | Cc1ccc(OC(C)C(=O)Nc2c(F)cccc2F)c(Br)c1 |
| InChI | InChI=1S/C16H14BrF2NO2/c1-9-6-7-14(11(17)8-9)22-10(2)16(21)20-15-12(18)4-3-5-13(15)19/h3-8,10H,1-2H3,(H,20,21) |
| InChIKey | RAOJKRMVORAIAZ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.19 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |