C19H17N3O4S — CID 512396
9-methoxy-1-[(3-nitrophenyl)methyl]-3,4-dihydro-2H-[1]benzothiolo[3,2-e][1,4]diazepin-5-one (PubChem CID 512396) has the molecular formula C19H17N3O4S and a molecular weight of 383.43 g/mol. Its IUPAC name is 9-methoxy-1-[(3-nitrophenyl)methyl]-3,4-dihydro-2H-[1]benzothiolo[3,2-e][1,4]diazepin-5-one.
| Compound Name | 9-methoxy-1-[(3-nitrophenyl)methyl]-3,4-dihydro-2H-[1]benzothiolo[3,2-e][1,4]diazepin-5-one |
|---|---|
| PubChem CID | 512396 |
| Molecular Formula | C19H17N3O4S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 9-methoxy-1-[(3-nitrophenyl)methyl]-3,4-dihydro-2H-[1]benzothiolo[3,2-e][1,4]diazepin-5-one |
| SMILES | COc1ccc2sc3c(c2c1)N(Cc1cccc([N+](=O)[O-])c1)CCNC3=O |
| InChI | InChI=1S/C19H17N3O4S/c1-26-14-5-6-16-15(10-14)17-18(27-16)19(23)20-7-8-21(17)11-12-3-2-4-13(9-12)22(24)25/h2-6,9-10H,7-8,11H2,1H3,(H,20,23) |
| InChIKey | ZIJMBZFYYQTRSY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|