C6H4I4N2 — CID 5124127
3,4,5,6-tetraiodobenzene-1,2-diamine (PubChem CID 5124127) has the molecular formula C6H4I4N2 and a molecular weight of 611.73 g/mol. Its IUPAC name is 3,4,5,6-tetraiodobenzene-1,2-diamine.
| Compound Name | 3,4,5,6-tetraiodobenzene-1,2-diamine |
|---|---|
| PubChem CID | 5124127 |
| Molecular Formula | C6H4I4N2 |
| Molecular Weight | 611.73 g/mol |
| Exact Mass | 611.66 |
| IUPAC Name | 3,4,5,6-tetraiodobenzene-1,2-diamine |
| SMILES | Nc1c(N)c(I)c(I)c(I)c1I |
| InChI | InChI=1S/C6H4I4N2/c7-1-2(8)4(10)6(12)5(11)3(1)9/h11-12H2 |
| InChIKey | SPLFBNDSDHZONT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.73 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|