About 2-(2,4-difluorophenoxy)-3-nitroimidazo[1,2-a]pyridine
2-(2,4-difluorophenoxy)-3-nitroimidazo[1,2-a]pyridine (PubChem CID 51245760) has the molecular formula C13H7F2N3O3
and a molecular weight of 291.21 g/mol. Its IUPAC name is 2-(2,4-difluorophenoxy)-3-nitroimidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 2-(2,4-difluorophenoxy)-3-nitroimidazo[1,2-a]pyridine |
| PubChem CID | 51245760 |
| Molecular Formula | C13H7F2N3O3 |
| Molecular Weight | 291.21 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 2-(2,4-difluorophenoxy)-3-nitroimidazo[1,2-a]pyridine |
| SMILES | O=[N+]([O-])c1c(Oc2ccc(F)cc2F)nc2ccccn12 |
| InChI | InChI=1S/C13H7F2N3O3/c14-8-4-5-10(9(15)7-8)21-12-13(18(19)20)17-6-2-1-3-11(17)16-12/h1-7H |
| InChIKey | DGODMRJUDFEULN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.21 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,4-difluorophenoxy)-3-nitroimidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-difluorophenoxy)-3-nitroimidazo[1,2-a]pyridine?
The IUPAC name of 2-(2,4-difluorophenoxy)-3-nitroimidazo[1,2-a]pyridine (CID 51245760) is 2-(2,4-difluorophenoxy)-3-nitroimidazo[1,2-a]pyridine.
What is the SMILES notation for 2-(2,4-difluorophenoxy)-3-nitroimidazo[1,2-a]pyridine?
The canonical SMILES for 2-(2,4-difluorophenoxy)-3-nitroimidazo[1,2-a]pyridine is O=[N+]([O-])c1c(Oc2ccc(F)cc2F)nc2ccccn12.
What is the InChIKey of 2-(2,4-difluorophenoxy)-3-nitroimidazo[1,2-a]pyridine?
The InChIKey is DGODMRJUDFEULN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7F2N3O3/c14-8-4-5-10(9(15)7-8)21-12-13(18(19)20)17-6-2-1-3-11(17)16-12/h1-7H.
What are the key properties of 2-(2,4-difluorophenoxy)-3-nitroimidazo[1,2-a]pyridine?
2-(2,4-difluorophenoxy)-3-nitroimidazo[1,2-a]pyridine has a molecular weight of 291.21 g/mol, XLogP of 3.31, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-difluorophenoxy)-3-nitroimidazo[1,2-a]pyridine is sourced from PubChem (CID 51245760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).