C19H22N4O2 — CID 51247748
4-(3-methylphenoxy)-N-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]butanamide (PubChem CID 51247748) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 4-(3-methylphenoxy)-N-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]butanamide.
| Compound Name | 4-(3-methylphenoxy)-N-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 51247748 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 4-(3-methylphenoxy)-N-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]butanamide |
| SMILES | Cc1cccc(OCCCC(=O)NC(C)c2nnc3ccccn23)c1 |
| InChI | InChI=1S/C19H22N4O2/c1-14-7-5-8-16(13-14)25-12-6-10-18(24)20-15(2)19-22-21-17-9-3-4-11-23(17)19/h3-5,7-9,11,13,15H,6,10,12H2,1-2H3,(H,20,24) |
| InChIKey | VGDKLTGBEGVRSM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|