C22H23N3O4 — CID 51248444
(E)-N-[2-[(2,3-dimethoxyphenyl)methyl]pyrazol-3-yl]-3-(3-methoxyphenyl)prop-2-enamide (PubChem CID 51248444) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is (E)-N-[2-[(2,3-dimethoxyphenyl)methyl]pyrazol-3-yl]-3-(3-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-[(2,3-dimethoxyphenyl)methyl]pyrazol-3-yl]-3-(3-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 51248444 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | (E)-N-[2-[(2,3-dimethoxyphenyl)methyl]pyrazol-3-yl]-3-(3-methoxyphenyl)prop-2-enamide |
| SMILES | COc1cccc(/C=C/C(=O)Nc2ccnn2Cc2cccc(OC)c2OC)c1 |
| InChI | InChI=1S/C22H23N3O4/c1-27-18-8-4-6-16(14-18)10-11-21(26)24-20-12-13-23-25(20)15-17-7-5-9-19(28-2)22(17)29-3/h4-14H,15H2,1-3H3,(H,24,26)/b11-10+ |
| InChIKey | WOYGNFCUZONEIN-ZHACJKMWSA-N |
| XLogP | 3.61 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|