About ethyl 6-fluoro-2,4-bis(trifluoromethyl)-1H-quinazoline-4-carboxylate
ethyl 6-fluoro-2,4-bis(trifluoromethyl)-1H-quinazoline-4-carboxylate (PubChem CID 5125055) has the molecular formula C13H9F7N2O2
and a molecular weight of 358.21 g/mol. Its IUPAC name is ethyl 6-fluoro-2,4-bis(trifluoromethyl)-1H-quinazoline-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 6-fluoro-2,4-bis(trifluoromethyl)-1H-quinazoline-4-carboxylate |
| PubChem CID | 5125055 |
| Molecular Formula | C13H9F7N2O2 |
| Molecular Weight | 358.21 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | ethyl 6-fluoro-2,4-bis(trifluoromethyl)-1H-quinazoline-4-carboxylate |
| SMILES | CCOC(=O)C1(C(F)(F)F)N=C(C(F)(F)F)Nc2ccc(F)cc21 |
| InChI | InChI=1S/C13H9F7N2O2/c1-2-24-10(23)11(13(18,19)20)7-5-6(14)3-4-8(7)21-9(22-11)12(15,16)17/h3-5H,2H2,1H3,(H,21,22) |
| InChIKey | LZZLEHQPBMSDDZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.21 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 6-fluoro-2,4-bis(trifluoromethyl)-1H-quinazoline-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-fluoro-2,4-bis(trifluoromethyl)-1H-quinazoline-4-carboxylate?
The IUPAC name of ethyl 6-fluoro-2,4-bis(trifluoromethyl)-1H-quinazoline-4-carboxylate (CID 5125055) is ethyl 6-fluoro-2,4-bis(trifluoromethyl)-1H-quinazoline-4-carboxylate.
What is the SMILES notation for ethyl 6-fluoro-2,4-bis(trifluoromethyl)-1H-quinazoline-4-carboxylate?
The canonical SMILES for ethyl 6-fluoro-2,4-bis(trifluoromethyl)-1H-quinazoline-4-carboxylate is CCOC(=O)C1(C(F)(F)F)N=C(C(F)(F)F)Nc2ccc(F)cc21.
What is the InChIKey of ethyl 6-fluoro-2,4-bis(trifluoromethyl)-1H-quinazoline-4-carboxylate?
The InChIKey is LZZLEHQPBMSDDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9F7N2O2/c1-2-24-10(23)11(13(18,19)20)7-5-6(14)3-4-8(7)21-9(22-11)12(15,16)17/h3-5H,2H2,1H3,(H,21,22).
What are the key properties of ethyl 6-fluoro-2,4-bis(trifluoromethyl)-1H-quinazoline-4-carboxylate?
ethyl 6-fluoro-2,4-bis(trifluoromethyl)-1H-quinazoline-4-carboxylate has a molecular weight of 358.21 g/mol, XLogP of 3.53, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-fluoro-2,4-bis(trifluoromethyl)-1H-quinazoline-4-carboxylate is sourced from PubChem (CID 5125055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).