About 2-[(2-anilino-1,3-thiazol-4-yl)methyl-propylamino]ethanol
2-[(2-anilino-1,3-thiazol-4-yl)methyl-propylamino]ethanol (PubChem CID 51254106) has the molecular formula C15H21N3OS
and a molecular weight of 291.42 g/mol. Its IUPAC name is 2-[(2-anilino-1,3-thiazol-4-yl)methyl-propylamino]ethanol.
Molecular Properties
| Compound Name | 2-[(2-anilino-1,3-thiazol-4-yl)methyl-propylamino]ethanol |
| PubChem CID | 51254106 |
| Molecular Formula | C15H21N3OS |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 2-[(2-anilino-1,3-thiazol-4-yl)methyl-propylamino]ethanol |
| SMILES | CCCN(CCO)Cc1csc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C15H21N3OS/c1-2-8-18(9-10-19)11-14-12-20-15(17-14)16-13-6-4-3-5-7-13/h3-7,12,19H,2,8-11H2,1H3,(H,16,17) |
| InChIKey | QKGADEZKFVGPJD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(2-anilino-1,3-thiazol-4-yl)methyl-propylamino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-anilino-1,3-thiazol-4-yl)methyl-propylamino]ethanol?
The IUPAC name of 2-[(2-anilino-1,3-thiazol-4-yl)methyl-propylamino]ethanol (CID 51254106) is 2-[(2-anilino-1,3-thiazol-4-yl)methyl-propylamino]ethanol.
What is the SMILES notation for 2-[(2-anilino-1,3-thiazol-4-yl)methyl-propylamino]ethanol?
The canonical SMILES for 2-[(2-anilino-1,3-thiazol-4-yl)methyl-propylamino]ethanol is CCCN(CCO)Cc1csc(Nc2ccccc2)n1.
What is the InChIKey of 2-[(2-anilino-1,3-thiazol-4-yl)methyl-propylamino]ethanol?
The InChIKey is QKGADEZKFVGPJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3OS/c1-2-8-18(9-10-19)11-14-12-20-15(17-14)16-13-6-4-3-5-7-13/h3-7,12,19H,2,8-11H2,1H3,(H,16,17).
What are the key properties of 2-[(2-anilino-1,3-thiazol-4-yl)methyl-propylamino]ethanol?
2-[(2-anilino-1,3-thiazol-4-yl)methyl-propylamino]ethanol has a molecular weight of 291.42 g/mol, XLogP of 3.09, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-anilino-1,3-thiazol-4-yl)methyl-propylamino]ethanol is sourced from PubChem (CID 51254106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).