C20H22N4O — CID 51254704
N-(1-benzylpiperidin-4-yl)imidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 51254704) has the molecular formula C20H22N4O and a molecular weight of 334.42 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)imidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)imidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 51254704 |
| Molecular Formula | C20H22N4O |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)imidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | O=C(NC1CCN(Cc2ccccc2)CC1)c1cn2ccccc2n1 |
| InChI | InChI=1S/C20H22N4O/c25-20(18-15-24-11-5-4-8-19(24)22-18)21-17-9-12-23(13-10-17)14-16-6-2-1-3-7-16/h1-8,11,15,17H,9-10,12-14H2,(H,21,25) |
| InChIKey | WTKFCRICYVERPV-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |