C14H17BrFNO4 — CID 51256426
propan-2-yl 3-[[2-(4-bromo-2-fluorophenoxy)acetyl]amino]propanoate (PubChem CID 51256426) has the molecular formula C14H17BrFNO4 and a molecular weight of 362.20 g/mol. Its IUPAC name is propan-2-yl 3-[[2-(4-bromo-2-fluorophenoxy)acetyl]amino]propanoate.
| Compound Name | propan-2-yl 3-[[2-(4-bromo-2-fluorophenoxy)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 51256426 |
| Molecular Formula | C14H17BrFNO4 |
| Molecular Weight | 362.20 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | propan-2-yl 3-[[2-(4-bromo-2-fluorophenoxy)acetyl]amino]propanoate |
| SMILES | CC(C)OC(=O)CCNC(=O)COc1ccc(Br)cc1F |
| InChI | InChI=1S/C14H17BrFNO4/c1-9(2)21-14(19)5-6-17-13(18)8-20-12-4-3-10(15)7-11(12)16/h3-4,7,9H,5-6,8H2,1-2H3,(H,17,18) |
| InChIKey | WBFMBPCHCQLOOO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.20 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |