C16H20N2O2S — CID 512567
(3S)-3-butan-2-yl-9-methoxy-1,2,3,4-tetrahydro-[1]benzothiolo[3,2-e][1,4]diazepin-5-one (PubChem CID 512567) has the molecular formula C16H20N2O2S and a molecular weight of 304.41 g/mol. Its IUPAC name is (3S)-3-butan-2-yl-9-methoxy-1,2,3,4-tetrahydro-[1]benzothiolo[3,2-e][1,4]diazepin-5-one.
| Compound Name | (3S)-3-butan-2-yl-9-methoxy-1,2,3,4-tetrahydro-[1]benzothiolo[3,2-e][1,4]diazepin-5-one |
|---|---|
| PubChem CID | 512567 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | (3S)-3-butan-2-yl-9-methoxy-1,2,3,4-tetrahydro-[1]benzothiolo[3,2-e][1,4]diazepin-5-one |
| SMILES | CCC(C)[C@H]1CNc2c(sc3ccc(OC)cc23)C(=O)N1 |
| InChI | InChI=1S/C16H20N2O2S/c1-4-9(2)12-8-17-14-11-7-10(20-3)5-6-13(11)21-15(14)16(19)18-12/h5-7,9,12,17H,4,8H2,1-3H3,(H,18,19)/t9?,12-/m1/s1 |
| InChIKey | RZKDGWRRBLNNCG-FFFFSGIJSA-N |
| XLogP | 3.48 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |