C19H21N5O2S — CID 51259319
2-(1-benzyltetrazol-5-yl)sulfanyl-N-[(2-methoxyphenyl)methyl]-N-methylacetamide (PubChem CID 51259319) has the molecular formula C19H21N5O2S and a molecular weight of 383.48 g/mol. Its IUPAC name is 2-(1-benzyltetrazol-5-yl)sulfanyl-N-[(2-methoxyphenyl)methyl]-N-methylacetamide.
| Compound Name | 2-(1-benzyltetrazol-5-yl)sulfanyl-N-[(2-methoxyphenyl)methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 51259319 |
| Molecular Formula | C19H21N5O2S |
| Molecular Weight | 383.48 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 2-(1-benzyltetrazol-5-yl)sulfanyl-N-[(2-methoxyphenyl)methyl]-N-methylacetamide |
| SMILES | COc1ccccc1CN(C)C(=O)CSc1nnnn1Cc1ccccc1 |
| InChI | InChI=1S/C19H21N5O2S/c1-23(13-16-10-6-7-11-17(16)26-2)18(25)14-27-19-20-21-22-24(19)12-15-8-4-3-5-9-15/h3-11H,12-14H2,1-2H3 |
| InChIKey | XFCBABJGWVISDV-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.48 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |