C27H26N2O4 — CID 5126002
7-methyl-2-(2-methylphenyl)-5-[1-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-3a,4,5,7a-tetrahydroisoindole-1,3-dione (PubChem CID 5126002) has the molecular formula C27H26N2O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is 7-methyl-2-(2-methylphenyl)-5-[1-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-3a,4,5,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 7-methyl-2-(2-methylphenyl)-5-[1-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-3a,4,5,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 5126002 |
| Molecular Formula | C27H26N2O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 7-methyl-2-(2-methylphenyl)-5-[1-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-3a,4,5,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CC1=CC(C2CC(=O)N(c3ccccc3C)C2=O)CC2C(=O)N(c3ccccc3C)C(=O)C12 |
| InChI | InChI=1S/C27H26N2O4/c1-15-8-4-6-10-21(15)28-23(30)14-19(25(28)31)18-12-17(3)24-20(13-18)26(32)29(27(24)33)22-11-7-5-9-16(22)2/h4-12,18-20,24H,13-14H2,1-3H3 |
| InChIKey | JQRMVDOOOSTCBW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|