C20H22FN5O2 — CID 51260416
N-[4-(4-fluorophenoxy)butyl]-3-phenyl-2-(tetrazol-1-yl)propanamide (PubChem CID 51260416) has the molecular formula C20H22FN5O2 and a molecular weight of 383.43 g/mol. Its IUPAC name is N-[4-(4-fluorophenoxy)butyl]-3-phenyl-2-(tetrazol-1-yl)propanamide.
| Compound Name | N-[4-(4-fluorophenoxy)butyl]-3-phenyl-2-(tetrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 51260416 |
| Molecular Formula | C20H22FN5O2 |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | N-[4-(4-fluorophenoxy)butyl]-3-phenyl-2-(tetrazol-1-yl)propanamide |
| SMILES | O=C(NCCCCOc1ccc(F)cc1)C(Cc1ccccc1)n1cnnn1 |
| InChI | InChI=1S/C20H22FN5O2/c21-17-8-10-18(11-9-17)28-13-5-4-12-22-20(27)19(26-15-23-24-25-26)14-16-6-2-1-3-7-16/h1-3,6-11,15,19H,4-5,12-14H2,(H,22,27) |
| InChIKey | TXBSEKAPUHNSON-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|