About 4-[2-(4-hydroxy-5,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]benzonitrile
4-[2-(4-hydroxy-5,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]benzonitrile (PubChem CID 51261608) has the molecular formula C20H22N2O4
and a molecular weight of 354.41 g/mol. Its IUPAC name is 4-[2-(4-hydroxy-5,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]benzonitrile.
Molecular Properties
| Compound Name | 4-[2-(4-hydroxy-5,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]benzonitrile |
| PubChem CID | 51261608 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 4-[2-(4-hydroxy-5,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]benzonitrile |
| SMILES | COc1ccc(OC)c2c1CN(CCOc1ccc(C#N)cc1)CC2O |
| InChI | InChI=1S/C20H22N2O4/c1-24-18-7-8-19(25-2)20-16(18)12-22(13-17(20)23)9-10-26-15-5-3-14(11-21)4-6-15/h3-8,17,23H,9-10,12-13H2,1-2H3 |
| InChIKey | SIXAZDZWGJNUSC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[2-(4-hydroxy-5,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(4-hydroxy-5,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]benzonitrile?
The IUPAC name of 4-[2-(4-hydroxy-5,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]benzonitrile (CID 51261608) is 4-[2-(4-hydroxy-5,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]benzonitrile.
What is the SMILES notation for 4-[2-(4-hydroxy-5,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]benzonitrile?
The canonical SMILES for 4-[2-(4-hydroxy-5,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]benzonitrile is COc1ccc(OC)c2c1CN(CCOc1ccc(C#N)cc1)CC2O.
What is the InChIKey of 4-[2-(4-hydroxy-5,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]benzonitrile?
The InChIKey is SIXAZDZWGJNUSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N2O4/c1-24-18-7-8-19(25-2)20-16(18)12-22(13-17(20)23)9-10-26-15-5-3-14(11-21)4-6-15/h3-8,17,23H,9-10,12-13H2,1-2H3.
What are the key properties of 4-[2-(4-hydroxy-5,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]benzonitrile?
4-[2-(4-hydroxy-5,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]benzonitrile has a molecular weight of 354.41 g/mol, XLogP of 2.50, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(4-hydroxy-5,8-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]benzonitrile is sourced from PubChem (CID 51261608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).