C20H28N4O2 — CID 51263125
N,N-diethyl-2-[4-[2-(1H-indol-3-yl)acetyl]piperazin-1-yl]acetamide (PubChem CID 51263125) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is N,N-diethyl-2-[4-[2-(1H-indol-3-yl)acetyl]piperazin-1-yl]acetamide.
| Compound Name | N,N-diethyl-2-[4-[2-(1H-indol-3-yl)acetyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 51263125 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | N,N-diethyl-2-[4-[2-(1H-indol-3-yl)acetyl]piperazin-1-yl]acetamide |
| SMILES | CCN(CC)C(=O)CN1CCN(C(=O)Cc2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C20H28N4O2/c1-3-23(4-2)20(26)15-22-9-11-24(12-10-22)19(25)13-16-14-21-18-8-6-5-7-17(16)18/h5-8,14,21H,3-4,9-13,15H2,1-2H3 |
| InChIKey | LANLHCIHQOXGFW-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 59.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |