C17H24N2O5 — CID 51265105
2-[2,6-dimethoxy-4-(3-methylpiperidine-1-carbonyl)phenoxy]acetamide (PubChem CID 51265105) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is 2-[2,6-dimethoxy-4-(3-methylpiperidine-1-carbonyl)phenoxy]acetamide.
| Compound Name | 2-[2,6-dimethoxy-4-(3-methylpiperidine-1-carbonyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 51265105 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 2-[2,6-dimethoxy-4-(3-methylpiperidine-1-carbonyl)phenoxy]acetamide |
| SMILES | COc1cc(C(=O)N2CCCC(C)C2)cc(OC)c1OCC(N)=O |
| InChI | InChI=1S/C17H24N2O5/c1-11-5-4-6-19(9-11)17(21)12-7-13(22-2)16(14(8-12)23-3)24-10-15(18)20/h7-8,11H,4-6,9-10H2,1-3H3,(H2,18,20) |
| InChIKey | MZVVZDZCWBPIRF-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 91.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |